C16H10Cl2N2 — CID 101434001
2-[2-(3,4-dichlorophenyl)phenyl]pyrimidine (PubChem CID 101434001) has the molecular formula C16H10Cl2N2 and a molecular weight of 301.18 g/mol. Its IUPAC name is 2-[2-(3,4-dichlorophenyl)phenyl]pyrimidine.
| Compound Name | 2-[2-(3,4-dichlorophenyl)phenyl]pyrimidine |
|---|---|
| PubChem CID | 101434001 |
| Molecular Formula | C16H10Cl2N2 |
| Molecular Weight | 301.18 g/mol |
| Exact Mass | 300.02 |
| IUPAC Name | 2-[2-(3,4-dichlorophenyl)phenyl]pyrimidine |
| SMILES | Clc1ccc(-c2ccccc2-c2ncccn2)cc1Cl |
| InChI | InChI=1S/C16H10Cl2N2/c17-14-7-6-11(10-15(14)18)12-4-1-2-5-13(12)16-19-8-3-9-20-16/h1-10H |
| InChIKey | LBMIYVGFFKTKAS-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.18 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |