C12H15F3N2 — CID 177335328
ethane;5-propan-2-yl-3-(trifluoromethyl)pyridine-2-carbonitrile (PubChem CID 177335328) has the molecular formula C12H15F3N2 and a molecular weight of 244.26 g/mol. Its IUPAC name is ethane;5-propan-2-yl-3-(trifluoromethyl)pyridine-2-carbonitrile.
| Compound Name | ethane;5-propan-2-yl-3-(trifluoromethyl)pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 177335328 |
| Molecular Formula | C12H15F3N2 |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | ethane;5-propan-2-yl-3-(trifluoromethyl)pyridine-2-carbonitrile |
| SMILES | CC.CC(C)c1cnc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C10H9F3N2.C2H6/c1-6(2)7-3-8(10(11,12)13)9(4-14)15-5-7;1-2/h3,5-6H,1-2H3;1-2H3 |
| InChIKey | XZHVALIFOSFOHE-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |