C14H16F6 — CID 88933481
2,5-di(propan-2-yl)-1,3-bis(trifluoromethyl)benzene (PubChem CID 88933481) has the molecular formula C14H16F6 and a molecular weight of 298.27 g/mol. Its IUPAC name is 2,5-di(propan-2-yl)-1,3-bis(trifluoromethyl)benzene.
| Compound Name | 2,5-di(propan-2-yl)-1,3-bis(trifluoromethyl)benzene |
|---|---|
| PubChem CID | 88933481 |
| Molecular Formula | C14H16F6 |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2,5-di(propan-2-yl)-1,3-bis(trifluoromethyl)benzene |
| SMILES | CC(C)c1cc(C(F)(F)F)c(C(C)C)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H16F6/c1-7(2)9-5-10(13(15,16)17)12(8(3)4)11(6-9)14(18,19)20/h5-8H,1-4H3 |
| InChIKey | BUUGLAVUNXHGRW-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |