C11H4Cl5N — CID 134623724
3,5-dichloro-4-(2,4,5-trichlorophenyl)pyridine (PubChem CID 134623724) has the molecular formula C11H4Cl5N and a molecular weight of 327.43 g/mol. Its IUPAC name is 3,5-dichloro-4-(2,4,5-trichlorophenyl)pyridine.
| Compound Name | 3,5-dichloro-4-(2,4,5-trichlorophenyl)pyridine |
|---|---|
| PubChem CID | 134623724 |
| Molecular Formula | C11H4Cl5N |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 324.88 |
| IUPAC Name | 3,5-dichloro-4-(2,4,5-trichlorophenyl)pyridine |
| SMILES | Clc1cc(Cl)c(-c2c(Cl)cncc2Cl)cc1Cl |
| InChI | InChI=1S/C11H4Cl5N/c12-6-2-8(14)7(13)1-5(6)11-9(15)3-17-4-10(11)16/h1-4H |
| InChIKey | SHJQOYTYKGEXKA-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|