C17H10Cl4N2 — CID 118806618
2,5-bis(2,5-dichlorophenyl)pyridin-4-amine (PubChem CID 118806618) has the molecular formula C17H10Cl4N2 and a molecular weight of 384.09 g/mol. Its IUPAC name is 2,5-bis(2,5-dichlorophenyl)pyridin-4-amine.
| Compound Name | 2,5-bis(2,5-dichlorophenyl)pyridin-4-amine |
|---|---|
| PubChem CID | 118806618 |
| Molecular Formula | C17H10Cl4N2 |
| Molecular Weight | 384.09 g/mol |
| Exact Mass | 381.96 |
| IUPAC Name | 2,5-bis(2,5-dichlorophenyl)pyridin-4-amine |
| SMILES | Nc1cc(-c2cc(Cl)ccc2Cl)ncc1-c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H10Cl4N2/c18-9-1-3-14(20)11(5-9)13-8-23-17(7-16(13)22)12-6-10(19)2-4-15(12)21/h1-8H,(H2,22,23) |
| InChIKey | MLYYDGDBYOCUQP-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.09 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |