C13H9Cl2N3 — CID 133094547
2-[5-amino-2-(2,5-dichlorophenyl)-4-pyridinyl]acetonitrile (PubChem CID 133094547) has the molecular formula C13H9Cl2N3 and a molecular weight of 278.14 g/mol. Its IUPAC name is 2-[5-amino-2-(2,5-dichlorophenyl)-4-pyridinyl]acetonitrile.
| Compound Name | 2-[5-amino-2-(2,5-dichlorophenyl)-4-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 133094547 |
| Molecular Formula | C13H9Cl2N3 |
| Molecular Weight | 278.14 g/mol |
| Exact Mass | 277.02 |
| IUPAC Name | 2-[5-amino-2-(2,5-dichlorophenyl)-4-pyridinyl]acetonitrile |
| SMILES | N#CCc1cc(-c2cc(Cl)ccc2Cl)ncc1N |
| InChI | InChI=1S/C13H9Cl2N3/c14-9-1-2-11(15)10(6-9)13-5-8(3-4-16)12(17)7-18-13/h1-2,5-7H,3,17H2 |
| InChIKey | IVGNEEMCZZTNGL-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 62.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.14 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |