C13H6Cl4N2 — CID 134636100
2-[5-chloro-2-(2,3,4-trichlorophenyl)-4-pyridinyl]acetonitrile (PubChem CID 134636100) has the molecular formula C13H6Cl4N2 and a molecular weight of 332.02 g/mol. Its IUPAC name is 2-[5-chloro-2-(2,3,4-trichlorophenyl)-4-pyridinyl]acetonitrile.
| Compound Name | 2-[5-chloro-2-(2,3,4-trichlorophenyl)-4-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 134636100 |
| Molecular Formula | C13H6Cl4N2 |
| Molecular Weight | 332.02 g/mol |
| Exact Mass | 329.93 |
| IUPAC Name | 2-[5-chloro-2-(2,3,4-trichlorophenyl)-4-pyridinyl]acetonitrile |
| SMILES | N#CCc1cc(-c2ccc(Cl)c(Cl)c2Cl)ncc1Cl |
| InChI | InChI=1S/C13H6Cl4N2/c14-9-2-1-8(12(16)13(9)17)11-5-7(3-4-18)10(15)6-19-11/h1-2,5-6H,3H2 |
| InChIKey | WRWXXQOXMBSDOJ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.02 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|