C18H6Cl6N2 — CID 134635784
2,6-bis(2,3,4-trichlorophenyl)pyridine-4-carbonitrile (PubChem CID 134635784) has the molecular formula C18H6Cl6N2 and a molecular weight of 462.98 g/mol. Its IUPAC name is 2,6-bis(2,3,4-trichlorophenyl)pyridine-4-carbonitrile.
| Compound Name | 2,6-bis(2,3,4-trichlorophenyl)pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 134635784 |
| Molecular Formula | C18H6Cl6N2 |
| Molecular Weight | 462.98 g/mol |
| Exact Mass | 459.87 |
| IUPAC Name | 2,6-bis(2,3,4-trichlorophenyl)pyridine-4-carbonitrile |
| SMILES | N#Cc1cc(-c2ccc(Cl)c(Cl)c2Cl)nc(-c2ccc(Cl)c(Cl)c2Cl)c1 |
| InChI | InChI=1S/C18H6Cl6N2/c19-11-3-1-9(15(21)17(11)23)13-5-8(7-25)6-14(26-13)10-2-4-12(20)18(24)16(10)22/h1-6H |
| InChIKey | YOSPMXVABBEFTJ-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.98 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|