C11H6Cl2FN — CID 118836279
2-(2,5-dichlorophenyl)-5-fluoropyridine (PubChem CID 118836279) has the molecular formula C11H6Cl2FN and a molecular weight of 242.08 g/mol. Its IUPAC name is 2-(2,5-dichlorophenyl)-5-fluoropyridine.
| Compound Name | 2-(2,5-dichlorophenyl)-5-fluoropyridine |
|---|---|
| PubChem CID | 118836279 |
| Molecular Formula | C11H6Cl2FN |
| Molecular Weight | 242.08 g/mol |
| Exact Mass | 240.99 |
| IUPAC Name | 2-(2,5-dichlorophenyl)-5-fluoropyridine |
| SMILES | Fc1ccc(-c2cc(Cl)ccc2Cl)nc1 |
| InChI | InChI=1S/C11H6Cl2FN/c12-7-1-3-10(13)9(5-7)11-4-2-8(14)6-15-11/h1-6H |
| InChIKey | DYTYKEWXRQBPGS-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.08 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |