C17H11Cl2NO2 — CID 67961044
4-(2,4-dichlorophenyl)-3-methylquinoline-6-carboxylic acid (PubChem CID 67961044) has the molecular formula C17H11Cl2NO2 and a molecular weight of 332.19 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-3-methylquinoline-6-carboxylic acid.
| Compound Name | 4-(2,4-dichlorophenyl)-3-methylquinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 67961044 |
| Molecular Formula | C17H11Cl2NO2 |
| Molecular Weight | 332.19 g/mol |
| Exact Mass | 331.02 |
| IUPAC Name | 4-(2,4-dichlorophenyl)-3-methylquinoline-6-carboxylic acid |
| SMILES | Cc1cnc2ccc(C(=O)O)cc2c1-c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C17H11Cl2NO2/c1-9-8-20-15-5-2-10(17(21)22)6-13(15)16(9)12-4-3-11(18)7-14(12)19/h2-8H,1H3,(H,21,22) |
| InChIKey | UQWPAZUKIYNDGN-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.19 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |