C15H12ClNO2 — CID 67961181
3-chloro-4-(cyclopenten-1-yl)quinoline-6-carboxylic acid (PubChem CID 67961181) has the molecular formula C15H12ClNO2 and a molecular weight of 273.72 g/mol. Its IUPAC name is 3-chloro-4-(cyclopenten-1-yl)quinoline-6-carboxylic acid.
| Compound Name | 3-chloro-4-(cyclopenten-1-yl)quinoline-6-carboxylic acid |
|---|---|
| PubChem CID | 67961181 |
| Molecular Formula | C15H12ClNO2 |
| Molecular Weight | 273.72 g/mol |
| Exact Mass | 273.06 |
| IUPAC Name | 3-chloro-4-(cyclopenten-1-yl)quinoline-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2ncc(Cl)c(C3=CCCC3)c2c1 |
| InChI | InChI=1S/C15H12ClNO2/c16-12-8-17-13-6-5-10(15(18)19)7-11(13)14(12)9-3-1-2-4-9/h3,5-8H,1-2,4H2,(H,18,19) |
| InChIKey | DERXFGFZPVCPIJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.72 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |