C16H11Cl2NO2 — CID 170838813
3-(2,4-dichlorophenyl)-1-methylindole-6-carboxylic acid (PubChem CID 170838813) has the molecular formula C16H11Cl2NO2 and a molecular weight of 320.18 g/mol. Its IUPAC name is 3-(2,4-dichlorophenyl)-1-methylindole-6-carboxylic acid.
| Compound Name | 3-(2,4-dichlorophenyl)-1-methylindole-6-carboxylic acid |
|---|---|
| PubChem CID | 170838813 |
| Molecular Formula | C16H11Cl2NO2 |
| Molecular Weight | 320.18 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 3-(2,4-dichlorophenyl)-1-methylindole-6-carboxylic acid |
| SMILES | Cn1cc(-c2ccc(Cl)cc2Cl)c2ccc(C(=O)O)cc21 |
| InChI | InChI=1S/C16H11Cl2NO2/c1-19-8-13(11-5-3-10(17)7-14(11)18)12-4-2-9(16(20)21)6-15(12)19/h2-8H,1H3,(H,20,21) |
| InChIKey | QFXFOFGJXPZWLA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.18 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |