C14H11ClN2O2 — CID 115110303
5-(6-chloro-1-methylindol-3-yl)-1H-pyrrole-2-carboxylic acid (PubChem CID 115110303) has the molecular formula C14H11ClN2O2 and a molecular weight of 274.71 g/mol. Its IUPAC name is 5-(6-chloro-1-methylindol-3-yl)-1H-pyrrole-2-carboxylic acid.
| Compound Name | 5-(6-chloro-1-methylindol-3-yl)-1H-pyrrole-2-carboxylic acid |
|---|---|
| PubChem CID | 115110303 |
| Molecular Formula | C14H11ClN2O2 |
| Molecular Weight | 274.71 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | 5-(6-chloro-1-methylindol-3-yl)-1H-pyrrole-2-carboxylic acid |
| SMILES | Cn1cc(-c2ccc(C(=O)O)[nH]2)c2ccc(Cl)cc21 |
| InChI | InChI=1S/C14H11ClN2O2/c1-17-7-10(9-3-2-8(15)6-13(9)17)11-4-5-12(16-11)14(18)19/h2-7,16H,1H3,(H,18,19) |
| InChIKey | NTVKQJPYGUARPW-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 58.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.71 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |