4-(2,4-dichlorophenyl)-8-methylquinoline-6-carboxylic acid

C17H11Cl2NO2 — CID 67961064

IUPAC4-(2,4-dichlorophenyl)-8-methylquinoline-6-carboxylic acid
SMILESCc1cc(C(=O)O)cc2c(-c3ccc(Cl)cc3Cl)ccnc12
InChIInChI=1S/C17H11Cl2NO2/c1-9-6-10(17(21)22)7-14-12(4-5-20-16(9)14)13-3-2-11(18)8-15(13)19/h2-8H,1H3,(H,21,22)
InChIKeyBYUWGSXFEJOBCZ-UHFFFAOYSA-N
MW332.19 g/mol
LogP5.22
Rot. Bonds2

About 4-(2,4-dichlorophenyl)-8-methylquinoline-6-carboxylic acid

4-(2,4-dichlorophenyl)-8-methylquinoline-6-carboxylic acid (PubChem CID 67961064) has the molecular formula C17H11Cl2NO2 and a molecular weight of 332.19 g/mol. Its IUPAC name is 4-(2,4-dichlorophenyl)-8-methylquinoline-6-carboxylic acid.

Molecular Properties

Compound Name4-(2,4-dichlorophenyl)-8-methylquinoline-6-carboxylic acid
PubChem CID67961064
Molecular FormulaC17H11Cl2NO2
Molecular Weight332.19 g/mol
Exact Mass331.02
IUPAC Name4-(2,4-dichlorophenyl)-8-methylquinoline-6-carboxylic acid
SMILESCc1cc(C(=O)O)cc2c(-c3ccc(Cl)cc3Cl)ccnc12
InChIInChI=1S/C17H11Cl2NO2/c1-9-6-10(17(21)22)7-14-12(4-5-20-16(9)14)13-3-2-11(18)8-15(13)19/h2-8H,1H3,(H,21,22)
InChIKeyBYUWGSXFEJOBCZ-UHFFFAOYSA-N
XLogP5.22
TPSA50.19 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms22
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500332.19
LogP ≤ 55.22
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 4-(2,4-dichlorophenyl)-8-methylquinoline-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,4-dichlorophenyl)-8-methylquinoline-6-carboxylic acid?
The IUPAC name of 4-(2,4-dichlorophenyl)-8-methylquinoline-6-carboxylic acid (CID 67961064) is 4-(2,4-dichlorophenyl)-8-methylquinoline-6-carboxylic acid.
What is the SMILES notation for 4-(2,4-dichlorophenyl)-8-methylquinoline-6-carboxylic acid?
The canonical SMILES for 4-(2,4-dichlorophenyl)-8-methylquinoline-6-carboxylic acid is Cc1cc(C(=O)O)cc2c(-c3ccc(Cl)cc3Cl)ccnc12.
What is the InChIKey of 4-(2,4-dichlorophenyl)-8-methylquinoline-6-carboxylic acid?
The InChIKey is BYUWGSXFEJOBCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H11Cl2NO2/c1-9-6-10(17(21)22)7-14-12(4-5-20-16(9)14)13-3-2-11(18)8-15(13)19/h2-8H,1H3,(H,21,22).
What are the key properties of 4-(2,4-dichlorophenyl)-8-methylquinoline-6-carboxylic acid?
4-(2,4-dichlorophenyl)-8-methylquinoline-6-carboxylic acid has a molecular weight of 332.19 g/mol, XLogP of 5.22, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,4-dichlorophenyl)-8-methylquinoline-6-carboxylic acid is sourced from PubChem (CID 67961064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).