C8H12N6O3 — CID 56762510
2-N-morpholin-4-yl-5-nitropyrimidine-2,4-diamine (PubChem CID 56762510) has the molecular formula C8H12N6O3 and a molecular weight of 240.22 g/mol. Its IUPAC name is 2-N-morpholin-4-yl-5-nitropyrimidine-2,4-diamine.
| Compound Name | 2-N-morpholin-4-yl-5-nitropyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 56762510 |
| Molecular Formula | C8H12N6O3 |
| Molecular Weight | 240.22 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 2-N-morpholin-4-yl-5-nitropyrimidine-2,4-diamine |
| SMILES | Nc1nc(NN2CCOCC2)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C8H12N6O3/c9-7-6(14(15)16)5-10-8(11-7)12-13-1-3-17-4-2-13/h5H,1-4H2,(H3,9,10,11,12) |
| InChIKey | IJYQLAHDJWBDSS-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 119.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.22 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|