C10H14N4O3 — CID 91325508
3-N-morpholin-4-yl-4-nitrobenzene-1,3-diamine (PubChem CID 91325508) has the molecular formula C10H14N4O3 and a molecular weight of 238.25 g/mol. Its IUPAC name is 3-N-morpholin-4-yl-4-nitrobenzene-1,3-diamine.
| Compound Name | 3-N-morpholin-4-yl-4-nitrobenzene-1,3-diamine |
|---|---|
| PubChem CID | 91325508 |
| Molecular Formula | C10H14N4O3 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 3-N-morpholin-4-yl-4-nitrobenzene-1,3-diamine |
| SMILES | Nc1ccc([N+](=O)[O-])c(NN2CCOCC2)c1 |
| InChI | InChI=1S/C10H14N4O3/c11-8-1-2-10(14(15)16)9(7-8)12-13-3-5-17-6-4-13/h1-2,7,12H,3-6,11H2 |
| InChIKey | PAZGNHSJDSWQMN-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 93.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|