C10H15N5O3 — CID 133495252
trans-(1S,2S)-2-[(4-amino-5-nitropyrimidin-2-yl)amino]cyclohexan-1-ol (PubChem CID 133495252) has the molecular formula C10H15N5O3 and a molecular weight of 253.26 g/mol. Its IUPAC name is trans-(1S,2S)-2-[(4-amino-5-nitropyrimidin-2-yl)amino]cyclohexan-1-ol.
| Compound Name | trans-(1S,2S)-2-[(4-amino-5-nitropyrimidin-2-yl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 133495252 |
| Molecular Formula | C10H15N5O3 |
| Molecular Weight | 253.26 g/mol |
| Exact Mass | 253.12 |
| IUPAC Name | trans-(1S,2S)-2-[(4-amino-5-nitropyrimidin-2-yl)amino]cyclohexan-1-ol |
| SMILES | Nc1nc(N[C@H]2CCCC[C@@H]2O)ncc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N5O3/c11-9-7(15(17)18)5-12-10(14-9)13-6-3-1-2-4-8(6)16/h5-6,8,16H,1-4H2,(H3,11,12,13,14)/t6-,8-/m0/s1 |
| InChIKey | NNMIUNUFMIIKKC-XPUUQOCRSA-N |
| XLogP | 0.68 |
| TPSA | 127.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.26 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|