C14H23N5O3 — CID 133441656
5-nitro-2-N-(2-pentan-3-yloxan-4-yl)pyrimidine-2,4-diamine (PubChem CID 133441656) has the molecular formula C14H23N5O3 and a molecular weight of 309.37 g/mol. Its IUPAC name is 5-nitro-2-N-(2-pentan-3-yloxan-4-yl)pyrimidine-2,4-diamine.
| Compound Name | 5-nitro-2-N-(2-pentan-3-yloxan-4-yl)pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 133441656 |
| Molecular Formula | C14H23N5O3 |
| Molecular Weight | 309.37 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | 5-nitro-2-N-(2-pentan-3-yloxan-4-yl)pyrimidine-2,4-diamine |
| SMILES | CCC(CC)C1CC(Nc2ncc([N+](=O)[O-])c(N)n2)CCO1 |
| InChI | InChI=1S/C14H23N5O3/c1-3-9(4-2)12-7-10(5-6-22-12)17-14-16-8-11(19(20)21)13(15)18-14/h8-10,12H,3-7H2,1-2H3,(H3,15,16,17,18) |
| InChIKey | XWEWXEBXWRGKBZ-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 116.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.37 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|