C15H21BrN2O4S — CID 100674633
5-bromo-3-nitro-N-[(2S,4R)-2-pentan-3-yloxan-4-yl]thiophene-2-carboxamide (PubChem CID 100674633) has the molecular formula C15H21BrN2O4S and a molecular weight of 405.31 g/mol. Its IUPAC name is 5-bromo-3-nitro-N-[(2S,4R)-2-pentan-3-yloxan-4-yl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-3-nitro-N-[(2S,4R)-2-pentan-3-yloxan-4-yl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 100674633 |
| Molecular Formula | C15H21BrN2O4S |
| Molecular Weight | 405.31 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | 5-bromo-3-nitro-N-[(2S,4R)-2-pentan-3-yloxan-4-yl]thiophene-2-carboxamide |
| SMILES | CCC(CC)[C@@H]1C[C@H](NC(=O)c2sc(Br)cc2[N+](=O)[O-])CCO1 |
| InChI | InChI=1S/C15H21BrN2O4S/c1-3-9(4-2)12-7-10(5-6-22-12)17-15(19)14-11(18(20)21)8-13(16)23-14/h8-10,12H,3-7H2,1-2H3,(H,17,19)/t10-,12+/m1/s1 |
| InChIKey | UPEDDBGWKMJIBO-PWSUYJOCSA-N |
| XLogP | 4.13 |
| TPSA | 81.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.31 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|