C17H24F2N2O2 — CID 97260482
1-(2,5-difluorophenyl)-3-[(2R,4R)-2-pentan-3-yloxan-4-yl]urea (PubChem CID 97260482) has the molecular formula C17H24F2N2O2 and a molecular weight of 326.39 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-3-[(2R,4R)-2-pentan-3-yloxan-4-yl]urea.
| Compound Name | 1-(2,5-difluorophenyl)-3-[(2R,4R)-2-pentan-3-yloxan-4-yl]urea |
|---|---|
| PubChem CID | 97260482 |
| Molecular Formula | C17H24F2N2O2 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.18 |
| IUPAC Name | 1-(2,5-difluorophenyl)-3-[(2R,4R)-2-pentan-3-yloxan-4-yl]urea |
| SMILES | CCC(CC)[C@H]1C[C@H](NC(=O)Nc2cc(F)ccc2F)CCO1 |
| InChI | InChI=1S/C17H24F2N2O2/c1-3-11(4-2)16-10-13(7-8-23-16)20-17(22)21-15-9-12(18)5-6-14(15)19/h5-6,9,11,13,16H,3-4,7-8,10H2,1-2H3,(H2,20,21,22)/t13-,16-/m1/s1 |
| InChIKey | JMBQOVQXTUNXCD-CZUORRHYSA-N |
| XLogP | 4.07 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |