C18H24F2N2O2 — CID 86793358
1-(2-cyclopropyloxan-4-yl)-3-[2-(2,4-difluorophenyl)propyl]urea (PubChem CID 86793358) has the molecular formula C18H24F2N2O2 and a molecular weight of 338.40 g/mol. Its IUPAC name is 1-(2-cyclopropyloxan-4-yl)-3-[2-(2,4-difluorophenyl)propyl]urea.
| Compound Name | 1-(2-cyclopropyloxan-4-yl)-3-[2-(2,4-difluorophenyl)propyl]urea |
|---|---|
| PubChem CID | 86793358 |
| Molecular Formula | C18H24F2N2O2 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 1-(2-cyclopropyloxan-4-yl)-3-[2-(2,4-difluorophenyl)propyl]urea |
| SMILES | CC(CNC(=O)NC1CCOC(C2CC2)C1)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H24F2N2O2/c1-11(15-5-4-13(19)8-16(15)20)10-21-18(23)22-14-6-7-24-17(9-14)12-2-3-12/h4-5,8,11-12,14,17H,2-3,6-7,9-10H2,1H3,(H2,21,22,23) |
| InChIKey | ABDBXKFVEAJMFS-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |