C18H24FN3O3 — CID 124571830
N-[2-[[(2R,4S)-2-cyclopropyloxan-4-yl]carbamoylamino]ethyl]-2-fluorobenzamide (PubChem CID 124571830) has the molecular formula C18H24FN3O3 and a molecular weight of 349.41 g/mol. Its IUPAC name is N-[2-[[(2R,4S)-2-cyclopropyloxan-4-yl]carbamoylamino]ethyl]-2-fluorobenzamide.
| Compound Name | N-[2-[[(2R,4S)-2-cyclopropyloxan-4-yl]carbamoylamino]ethyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 124571830 |
| Molecular Formula | C18H24FN3O3 |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | N-[2-[[(2R,4S)-2-cyclopropyloxan-4-yl]carbamoylamino]ethyl]-2-fluorobenzamide |
| SMILES | O=C(NCCNC(=O)c1ccccc1F)N[C@H]1CCO[C@@H](C2CC2)C1 |
| InChI | InChI=1S/C18H24FN3O3/c19-15-4-2-1-3-14(15)17(23)20-8-9-21-18(24)22-13-7-10-25-16(11-13)12-5-6-12/h1-4,12-13,16H,5-11H2,(H,20,23)(H2,21,22,24)/t13-,16+/m0/s1 |
| InChIKey | PATRYTFEEBCRNK-XJKSGUPXSA-N |
| XLogP | 1.81 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|