C17H24N2O2S — CID 125137959
1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-(2-methyl-3-methylsulfanylphenyl)urea (PubChem CID 125137959) has the molecular formula C17H24N2O2S and a molecular weight of 320.46 g/mol. Its IUPAC name is 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-(2-methyl-3-methylsulfanylphenyl)urea.
| Compound Name | 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-(2-methyl-3-methylsulfanylphenyl)urea |
|---|---|
| PubChem CID | 125137959 |
| Molecular Formula | C17H24N2O2S |
| Molecular Weight | 320.46 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-(2-methyl-3-methylsulfanylphenyl)urea |
| SMILES | CSc1cccc(NC(=O)N[C@H]2CCO[C@H](C3CC3)C2)c1C |
| InChI | InChI=1S/C17H24N2O2S/c1-11-14(4-3-5-16(11)22-2)19-17(20)18-13-8-9-21-15(10-13)12-6-7-12/h3-5,12-13,15H,6-10H2,1-2H3,(H2,18,19,20)/t13-,15-/m0/s1 |
| InChIKey | XPHRWJXIYPZTDU-ZFWWWQNUSA-N |
| XLogP | 3.80 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |