C14H20N4O3 — CID 125139278
1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-(2-methoxypyrimidin-4-yl)urea (PubChem CID 125139278) has the molecular formula C14H20N4O3 and a molecular weight of 292.34 g/mol. Its IUPAC name is 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-(2-methoxypyrimidin-4-yl)urea.
| Compound Name | 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-(2-methoxypyrimidin-4-yl)urea |
|---|---|
| PubChem CID | 125139278 |
| Molecular Formula | C14H20N4O3 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.15 |
| IUPAC Name | 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-(2-methoxypyrimidin-4-yl)urea |
| SMILES | COc1nccc(NC(=O)N[C@H]2CCO[C@H](C3CC3)C2)n1 |
| InChI | InChI=1S/C14H20N4O3/c1-20-14-15-6-4-12(18-14)17-13(19)16-10-5-7-21-11(8-10)9-2-3-9/h4,6,9-11H,2-3,5,7-8H2,1H3,(H2,15,16,17,18,19)/t10-,11-/m0/s1 |
| InChIKey | BVPYYMAOCQUAHK-QWRGUYRKSA-N |
| XLogP | 1.56 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |