About 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea
1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea (PubChem CID 97308610) has the molecular formula C19H29N3O2
and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea.
Molecular Properties
| Compound Name | 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea |
| PubChem CID | 97308610 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea |
| SMILES | CC(C)C[C@H](NC(=O)N[C@H]1CCO[C@H](C2CC2)C1)c1ccccn1 |
| InChI | InChI=1S/C19H29N3O2/c1-13(2)11-17(16-5-3-4-9-20-16)22-19(23)21-15-8-10-24-18(12-15)14-6-7-14/h3-5,9,13-15,17-18H,6-8,10-12H2,1-2H3,(H2,21,22,23)/t15-,17-,18-/m0/s1 |
| InChIKey | KXEOEFYBUNOYOE-SZMVWBNQSA-N |
| XLogP | 3.43 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea?
The IUPAC name of 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea (CID 97308610) is 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea.
What is the SMILES notation for 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea?
The canonical SMILES for 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea is CC(C)C[C@H](NC(=O)N[C@H]1CCO[C@H](C2CC2)C1)c1ccccn1.
What is the InChIKey of 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea?
The InChIKey is KXEOEFYBUNOYOE-SZMVWBNQSA-N. The full InChI is InChI=1S/C19H29N3O2/c1-13(2)11-17(16-5-3-4-9-20-16)22-19(23)21-15-8-10-24-18(12-15)14-6-7-14/h3-5,9,13-15,17-18H,6-8,10-12H2,1-2H3,(H2,21,22,23)/t15-,17-,18-/m0/s1.
What are the key properties of 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea?
1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea has a molecular weight of 331.46 g/mol, XLogP of 3.43, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea is sourced from PubChem (CID 97308610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).