C19H29N3O2 — CID 97308610
1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea (PubChem CID 97308610) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea.
| Compound Name | 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea |
|---|---|
| PubChem CID | 97308610 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 1-[(2S,4S)-2-cyclopropyloxan-4-yl]-3-[(1S)-3-methyl-1-pyridin-2-ylbutyl]urea |
| SMILES | CC(C)C[C@H](NC(=O)N[C@H]1CCO[C@H](C2CC2)C1)c1ccccn1 |
| InChI | InChI=1S/C19H29N3O2/c1-13(2)11-17(16-5-3-4-9-20-16)22-19(23)21-15-8-10-24-18(12-15)14-6-7-14/h3-5,9,13-15,17-18H,6-8,10-12H2,1-2H3,(H2,21,22,23)/t15-,17-,18-/m0/s1 |
| InChIKey | KXEOEFYBUNOYOE-SZMVWBNQSA-N |
| XLogP | 3.43 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |