C16H19F3N2O3 — CID 75507899
1-(2-cyclopropyloxan-4-yl)-3-[2-(difluoromethoxy)-5-fluorophenyl]urea (PubChem CID 75507899) has the molecular formula C16H19F3N2O3 and a molecular weight of 344.33 g/mol. Its IUPAC name is 1-(2-cyclopropyloxan-4-yl)-3-[2-(difluoromethoxy)-5-fluorophenyl]urea.
| Compound Name | 1-(2-cyclopropyloxan-4-yl)-3-[2-(difluoromethoxy)-5-fluorophenyl]urea |
|---|---|
| PubChem CID | 75507899 |
| Molecular Formula | C16H19F3N2O3 |
| Molecular Weight | 344.33 g/mol |
| Exact Mass | 344.13 |
| IUPAC Name | 1-(2-cyclopropyloxan-4-yl)-3-[2-(difluoromethoxy)-5-fluorophenyl]urea |
| SMILES | O=C(Nc1cc(F)ccc1OC(F)F)NC1CCOC(C2CC2)C1 |
| InChI | InChI=1S/C16H19F3N2O3/c17-10-3-4-13(24-15(18)19)12(7-10)21-16(22)20-11-5-6-23-14(8-11)9-1-2-9/h3-4,7,9,11,14-15H,1-2,5-6,8H2,(H2,20,21,22) |
| InChIKey | GZLKVCBVWNAYGX-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.33 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |