C16H25N5O3 — CID 136540973
1-(2-methoxypyrimidin-4-yl)-3-[1-(3-methylbutanoyl)piperidin-4-yl]urea (PubChem CID 136540973) has the molecular formula C16H25N5O3 and a molecular weight of 335.41 g/mol. Its IUPAC name is 1-(2-methoxypyrimidin-4-yl)-3-[1-(3-methylbutanoyl)piperidin-4-yl]urea.
| Compound Name | 1-(2-methoxypyrimidin-4-yl)-3-[1-(3-methylbutanoyl)piperidin-4-yl]urea |
|---|---|
| PubChem CID | 136540973 |
| Molecular Formula | C16H25N5O3 |
| Molecular Weight | 335.41 g/mol |
| Exact Mass | 335.20 |
| IUPAC Name | 1-(2-methoxypyrimidin-4-yl)-3-[1-(3-methylbutanoyl)piperidin-4-yl]urea |
| SMILES | COc1nccc(NC(=O)NC2CCN(C(=O)CC(C)C)CC2)n1 |
| InChI | InChI=1S/C16H25N5O3/c1-11(2)10-14(22)21-8-5-12(6-9-21)18-15(23)19-13-4-7-17-16(20-13)24-3/h4,7,11-12H,5-6,8-10H2,1-3H3,(H2,17,18,19,20,23) |
| InChIKey | MJLDJNJMDLWXIM-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 96.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.41 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |