C21H30N2O2 — CID 124623277
1-[(2R,4R)-2-cyclopropyloxan-4-yl]-3-(2-propan-2-yl-6-prop-2-enylphenyl)urea (PubChem CID 124623277) has the molecular formula C21H30N2O2 and a molecular weight of 342.48 g/mol. Its IUPAC name is 1-[(2R,4R)-2-cyclopropyloxan-4-yl]-3-(2-propan-2-yl-6-prop-2-enylphenyl)urea.
| Compound Name | 1-[(2R,4R)-2-cyclopropyloxan-4-yl]-3-(2-propan-2-yl-6-prop-2-enylphenyl)urea |
|---|---|
| PubChem CID | 124623277 |
| Molecular Formula | C21H30N2O2 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.23 |
| IUPAC Name | 1-[(2R,4R)-2-cyclopropyloxan-4-yl]-3-(2-propan-2-yl-6-prop-2-enylphenyl)urea |
| SMILES | C=CCc1cccc(C(C)C)c1NC(=O)N[C@@H]1CCO[C@@H](C2CC2)C1 |
| InChI | InChI=1S/C21H30N2O2/c1-4-6-16-7-5-8-18(14(2)3)20(16)23-21(24)22-17-11-12-25-19(13-17)15-9-10-15/h4-5,7-8,14-15,17,19H,1,6,9-13H2,2-3H3,(H2,22,23,24)/t17-,19-/m1/s1 |
| InChIKey | VVPBSAZPLBORDX-IEBWSBKVSA-N |
| XLogP | 4.62 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|