C20H26N4O — CID 124733221
1-(2-propan-2-yl-6-prop-2-enylphenyl)-3-[(6R)-4,5,6,7-tetrahydro-1H-indazol-6-yl]urea (PubChem CID 124733221) has the molecular formula C20H26N4O and a molecular weight of 338.46 g/mol. Its IUPAC name is 1-(2-propan-2-yl-6-prop-2-enylphenyl)-3-[(6R)-4,5,6,7-tetrahydro-1H-indazol-6-yl]urea.
| Compound Name | 1-(2-propan-2-yl-6-prop-2-enylphenyl)-3-[(6R)-4,5,6,7-tetrahydro-1H-indazol-6-yl]urea |
|---|---|
| PubChem CID | 124733221 |
| Molecular Formula | C20H26N4O |
| Molecular Weight | 338.46 g/mol |
| Exact Mass | 338.21 |
| IUPAC Name | 1-(2-propan-2-yl-6-prop-2-enylphenyl)-3-[(6R)-4,5,6,7-tetrahydro-1H-indazol-6-yl]urea |
| SMILES | C=CCc1cccc(C(C)C)c1NC(=O)N[C@@H]1CCc2cn[nH]c2C1 |
| InChI | InChI=1S/C20H26N4O/c1-4-6-14-7-5-8-17(13(2)3)19(14)23-20(25)22-16-10-9-15-12-21-24-18(15)11-16/h4-5,7-8,12-13,16H,1,6,9-11H2,2-3H3,(H,21,24)(H2,22,23,25)/t16-/m1/s1 |
| InChIKey | KRFXFFSVIMXGIA-MRXNPFEDSA-N |
| XLogP | 3.94 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.46 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|