C19H29NO2 — CID 154756403
(2S,4S)-N-[2,6-di(propan-2-yl)phenyl]-4-methyloxane-2-carboxamide (PubChem CID 154756403) has the molecular formula C19H29NO2 and a molecular weight of 303.45 g/mol. Its IUPAC name is (2S,4S)-N-[2,6-di(propan-2-yl)phenyl]-4-methyloxane-2-carboxamide.
| Compound Name | (2S,4S)-N-[2,6-di(propan-2-yl)phenyl]-4-methyloxane-2-carboxamide |
|---|---|
| PubChem CID | 154756403 |
| Molecular Formula | C19H29NO2 |
| Molecular Weight | 303.45 g/mol |
| Exact Mass | 303.22 |
| IUPAC Name | (2S,4S)-N-[2,6-di(propan-2-yl)phenyl]-4-methyloxane-2-carboxamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)[C@@H]1C[C@@H](C)CCO1 |
| InChI | InChI=1S/C19H29NO2/c1-12(2)15-7-6-8-16(13(3)4)18(15)20-19(21)17-11-14(5)9-10-22-17/h6-8,12-14,17H,9-11H2,1-5H3,(H,20,21)/t14-,17-/m0/s1 |
| InChIKey | DPIJZEOLYFZXHU-YOEHRIQHSA-N |
| XLogP | 4.69 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.45 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |