C19H30N2O — CID 120616178
(2S,4S)-N-[2,6-di(propan-2-yl)phenyl]-2-methylpiperidine-4-carboxamide (PubChem CID 120616178) has the molecular formula C19H30N2O and a molecular weight of 302.46 g/mol. Its IUPAC name is (2S,4S)-N-[2,6-di(propan-2-yl)phenyl]-2-methylpiperidine-4-carboxamide.
| Compound Name | (2S,4S)-N-[2,6-di(propan-2-yl)phenyl]-2-methylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 120616178 |
| Molecular Formula | C19H30N2O |
| Molecular Weight | 302.46 g/mol |
| Exact Mass | 302.24 |
| IUPAC Name | (2S,4S)-N-[2,6-di(propan-2-yl)phenyl]-2-methylpiperidine-4-carboxamide |
| SMILES | CC(C)c1cccc(C(C)C)c1NC(=O)[C@H]1CCN[C@@H](C)C1 |
| InChI | InChI=1S/C19H30N2O/c1-12(2)16-7-6-8-17(13(3)4)18(16)21-19(22)15-9-10-20-14(5)11-15/h6-8,12-15,20H,9-11H2,1-5H3,(H,21,22)/t14-,15-/m0/s1 |
| InChIKey | WIMNPUQNAZMYCH-GJZGRUSLSA-N |
| XLogP | 4.26 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.46 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |