C18H23F4N3O2 — CID 71885532
2-fluoro-N-[3-[[2-(trifluoromethyl)cyclohexyl]carbamoylamino]propyl]benzamide (PubChem CID 71885532) has the molecular formula C18H23F4N3O2 and a molecular weight of 389.39 g/mol. Its IUPAC name is 2-fluoro-N-[3-[[2-(trifluoromethyl)cyclohexyl]carbamoylamino]propyl]benzamide.
| Compound Name | 2-fluoro-N-[3-[[2-(trifluoromethyl)cyclohexyl]carbamoylamino]propyl]benzamide |
|---|---|
| PubChem CID | 71885532 |
| Molecular Formula | C18H23F4N3O2 |
| Molecular Weight | 389.39 g/mol |
| Exact Mass | 389.17 |
| IUPAC Name | 2-fluoro-N-[3-[[2-(trifluoromethyl)cyclohexyl]carbamoylamino]propyl]benzamide |
| SMILES | O=C(NCCCNC(=O)c1ccccc1F)NC1CCCCC1C(F)(F)F |
| InChI | InChI=1S/C18H23F4N3O2/c19-14-8-3-1-6-12(14)16(26)23-10-5-11-24-17(27)25-15-9-4-2-7-13(15)18(20,21)22/h1,3,6,8,13,15H,2,4-5,7,9-11H2,(H,23,26)(H2,24,25,27) |
| InChIKey | JBOUTWBMERPZJY-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.39 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|