C18H23F2N3O2 — CID 132971826
1-(1-cyclobutyl-2-oxopyrrolidin-3-yl)-3-[2-(2,4-difluorophenyl)propyl]urea (PubChem CID 132971826) has the molecular formula C18H23F2N3O2 and a molecular weight of 351.40 g/mol. Its IUPAC name is 1-(1-cyclobutyl-2-oxopyrrolidin-3-yl)-3-[2-(2,4-difluorophenyl)propyl]urea.
| Compound Name | 1-(1-cyclobutyl-2-oxopyrrolidin-3-yl)-3-[2-(2,4-difluorophenyl)propyl]urea |
|---|---|
| PubChem CID | 132971826 |
| Molecular Formula | C18H23F2N3O2 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 1-(1-cyclobutyl-2-oxopyrrolidin-3-yl)-3-[2-(2,4-difluorophenyl)propyl]urea |
| SMILES | CC(CNC(=O)NC1CCN(C2CCC2)C1=O)c1ccc(F)cc1F |
| InChI | InChI=1S/C18H23F2N3O2/c1-11(14-6-5-12(19)9-15(14)20)10-21-18(25)22-16-7-8-23(17(16)24)13-3-2-4-13/h5-6,9,11,13,16H,2-4,7-8,10H2,1H3,(H2,21,22,25) |
| InChIKey | HWXOJVZZJRITPP-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |