C19H25FN4O3 — CID 138037578
1-(1-cyclobutyl-2-oxopyrrolidin-3-yl)-3-(4-fluoro-2-morpholin-4-ylphenyl)urea (PubChem CID 138037578) has the molecular formula C19H25FN4O3 and a molecular weight of 376.43 g/mol. Its IUPAC name is 1-(1-cyclobutyl-2-oxopyrrolidin-3-yl)-3-(4-fluoro-2-morpholin-4-ylphenyl)urea.
| Compound Name | 1-(1-cyclobutyl-2-oxopyrrolidin-3-yl)-3-(4-fluoro-2-morpholin-4-ylphenyl)urea |
|---|---|
| PubChem CID | 138037578 |
| Molecular Formula | C19H25FN4O3 |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.19 |
| IUPAC Name | 1-(1-cyclobutyl-2-oxopyrrolidin-3-yl)-3-(4-fluoro-2-morpholin-4-ylphenyl)urea |
| SMILES | O=C(Nc1ccc(F)cc1N1CCOCC1)NC1CCN(C2CCC2)C1=O |
| InChI | InChI=1S/C19H25FN4O3/c20-13-4-5-15(17(12-13)23-8-10-27-11-9-23)21-19(26)22-16-6-7-24(18(16)25)14-2-1-3-14/h4-5,12,14,16H,1-3,6-11H2,(H2,21,22,26) |
| InChIKey | RCBXREPXDUAILP-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |