C21H30N4O3 — CID 154743880
1-[1-(oxan-4-yl)-2-oxopyrrolidin-3-yl]-3-(2-piperidin-1-ylphenyl)urea (PubChem CID 154743880) has the molecular formula C21H30N4O3 and a molecular weight of 386.50 g/mol. Its IUPAC name is 1-[1-(oxan-4-yl)-2-oxopyrrolidin-3-yl]-3-(2-piperidin-1-ylphenyl)urea.
| Compound Name | 1-[1-(oxan-4-yl)-2-oxopyrrolidin-3-yl]-3-(2-piperidin-1-ylphenyl)urea |
|---|---|
| PubChem CID | 154743880 |
| Molecular Formula | C21H30N4O3 |
| Molecular Weight | 386.50 g/mol |
| Exact Mass | 386.23 |
| IUPAC Name | 1-[1-(oxan-4-yl)-2-oxopyrrolidin-3-yl]-3-(2-piperidin-1-ylphenyl)urea |
| SMILES | O=C(Nc1ccccc1N1CCCCC1)NC1CCN(C2CCOCC2)C1=O |
| InChI | InChI=1S/C21H30N4O3/c26-20-18(8-13-25(20)16-9-14-28-15-10-16)23-21(27)22-17-6-2-3-7-19(17)24-11-4-1-5-12-24/h2-3,6-7,16,18H,1,4-5,8-15H2,(H2,22,23,27) |
| InChIKey | HPLRMQIVYUWTAQ-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 73.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.50 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |