C22H31N3O3 — CID 113185559
1-cycloheptyl-N-(2-morpholin-4-ylphenyl)-5-oxopyrrolidine-3-carboxamide (PubChem CID 113185559) has the molecular formula C22H31N3O3 and a molecular weight of 385.51 g/mol. Its IUPAC name is 1-cycloheptyl-N-(2-morpholin-4-ylphenyl)-5-oxopyrrolidine-3-carboxamide.
| Compound Name | 1-cycloheptyl-N-(2-morpholin-4-ylphenyl)-5-oxopyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 113185559 |
| Molecular Formula | C22H31N3O3 |
| Molecular Weight | 385.51 g/mol |
| Exact Mass | 385.24 |
| IUPAC Name | 1-cycloheptyl-N-(2-morpholin-4-ylphenyl)-5-oxopyrrolidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1N1CCOCC1)C1CC(=O)N(C2CCCCCC2)C1 |
| InChI | InChI=1S/C22H31N3O3/c26-21-15-17(16-25(21)18-7-3-1-2-4-8-18)22(27)23-19-9-5-6-10-20(19)24-11-13-28-14-12-24/h5-6,9-10,17-18H,1-4,7-8,11-16H2,(H,23,27) |
| InChIKey | BLDLWPZDEWKVEU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.51 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |