C15H19F2N3O3 — CID 71893342
1-[2-(2,4-difluorophenyl)-2-hydroxyethyl]-3-(2-oxoazepan-3-yl)urea (PubChem CID 71893342) has the molecular formula C15H19F2N3O3 and a molecular weight of 327.33 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenyl)-2-hydroxyethyl]-3-(2-oxoazepan-3-yl)urea.
| Compound Name | 1-[2-(2,4-difluorophenyl)-2-hydroxyethyl]-3-(2-oxoazepan-3-yl)urea |
|---|---|
| PubChem CID | 71893342 |
| Molecular Formula | C15H19F2N3O3 |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 1-[2-(2,4-difluorophenyl)-2-hydroxyethyl]-3-(2-oxoazepan-3-yl)urea |
| SMILES | O=C(NCC(O)c1ccc(F)cc1F)NC1CCCCNC1=O |
| InChI | InChI=1S/C15H19F2N3O3/c16-9-4-5-10(11(17)7-9)13(21)8-19-15(23)20-12-3-1-2-6-18-14(12)22/h4-5,7,12-13,21H,1-3,6,8H2,(H,18,22)(H2,19,20,23) |
| InChIKey | BZTHFBVOZNXJMA-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |