C13H16ClN3O2 — CID 2805571
1-(4-chlorophenyl)-3-(2-oxoazepan-3-yl)urea (PubChem CID 2805571) has the molecular formula C13H16ClN3O2 and a molecular weight of 281.74 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3-(2-oxoazepan-3-yl)urea.
| Compound Name | 1-(4-chlorophenyl)-3-(2-oxoazepan-3-yl)urea |
|---|---|
| PubChem CID | 2805571 |
| Molecular Formula | C13H16ClN3O2 |
| Molecular Weight | 281.74 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | 1-(4-chlorophenyl)-3-(2-oxoazepan-3-yl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)NC1CCCCNC1=O |
| InChI | InChI=1S/C13H16ClN3O2/c14-9-4-6-10(7-5-9)16-13(19)17-11-3-1-2-8-15-12(11)18/h4-7,11H,1-3,8H2,(H,15,18)(H2,16,17,19) |
| InChIKey | KGIGQKCLQJAGTK-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.74 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |