C28H30N6O5 — CID 90950764
ethyl 4-(4-butoxyphenyl)-2-[2-[2-(5-nitro-2-pyridinyl)pyrrol-2-yl]ethylamino]pyrimidine-5-carboxylate (PubChem CID 90950764) has the molecular formula C28H30N6O5 and a molecular weight of 530.59 g/mol. Its IUPAC name is ethyl 4-(4-butoxyphenyl)-2-[2-[2-(5-nitro-2-pyridinyl)pyrrol-2-yl]ethylamino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-(4-butoxyphenyl)-2-[2-[2-(5-nitro-2-pyridinyl)pyrrol-2-yl]ethylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 90950764 |
| Molecular Formula | C28H30N6O5 |
| Molecular Weight | 530.59 g/mol |
| Exact Mass | 530.23 |
| IUPAC Name | ethyl 4-(4-butoxyphenyl)-2-[2-[2-(5-nitro-2-pyridinyl)pyrrol-2-yl]ethylamino]pyrimidine-5-carboxylate |
| SMILES | CCCCOc1ccc(-c2nc(NCCC3(c4ccc([N+](=O)[O-])cn4)C=CC=N3)ncc2C(=O)OCC)cc1 |
| InChI | InChI=1S/C28H30N6O5/c1-3-5-17-39-22-10-7-20(8-11-22)25-23(26(35)38-4-2)19-31-27(33-25)29-16-14-28(13-6-15-32-28)24-12-9-21(18-30-24)34(36)37/h6-13,15,18-19H,3-5,14,16-17H2,1-2H3,(H,29,31,33) |
| InChIKey | VDVBPJCJNWJJDH-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 141.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.59 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|