C28H24N6O4 — CID 91594441
ethyl 4-naphthalen-1-yl-2-[2-[2-(5-nitro-2-pyridinyl)pyrrol-2-yl]ethylamino]pyrimidine-5-carboxylate (PubChem CID 91594441) has the molecular formula C28H24N6O4 and a molecular weight of 508.54 g/mol. Its IUPAC name is ethyl 4-naphthalen-1-yl-2-[2-[2-(5-nitro-2-pyridinyl)pyrrol-2-yl]ethylamino]pyrimidine-5-carboxylate.
| Compound Name | ethyl 4-naphthalen-1-yl-2-[2-[2-(5-nitro-2-pyridinyl)pyrrol-2-yl]ethylamino]pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 91594441 |
| Molecular Formula | C28H24N6O4 |
| Molecular Weight | 508.54 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | ethyl 4-naphthalen-1-yl-2-[2-[2-(5-nitro-2-pyridinyl)pyrrol-2-yl]ethylamino]pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(NCCC2(c3ccc([N+](=O)[O-])cn3)C=CC=N2)nc1-c1cccc2ccccc12 |
| InChI | InChI=1S/C28H24N6O4/c1-2-38-26(35)23-18-31-27(33-25(23)22-10-5-8-19-7-3-4-9-21(19)22)29-16-14-28(13-6-15-32-28)24-12-11-20(17-30-24)34(36)37/h3-13,15,17-18H,2,14,16H2,1H3,(H,29,31,33) |
| InChIKey | NEMYHBWNHTZYAW-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 132.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.54 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|