C24H22N6O4 — CID 173279153
4-ethyl-6-naphthalen-2-yl-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylic acid (PubChem CID 173279153) has the molecular formula C24H22N6O4 and a molecular weight of 458.48 g/mol. Its IUPAC name is 4-ethyl-6-naphthalen-2-yl-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylic acid.
| Compound Name | 4-ethyl-6-naphthalen-2-yl-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylic acid |
|---|---|
| PubChem CID | 173279153 |
| Molecular Formula | C24H22N6O4 |
| Molecular Weight | 458.48 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 4-ethyl-6-naphthalen-2-yl-2-[2-[(5-nitro-2-pyridinyl)amino]ethylamino]pyrimidine-5-carboxylic acid |
| SMILES | CCc1nc(NCCNc2ccc([N+](=O)[O-])cn2)nc(-c2ccc3ccccc3c2)c1C(=O)O |
| InChI | InChI=1S/C24H22N6O4/c1-2-19-21(23(31)32)22(17-8-7-15-5-3-4-6-16(15)13-17)29-24(28-19)26-12-11-25-20-10-9-18(14-27-20)30(33)34/h3-10,13-14H,2,11-12H2,1H3,(H,25,27)(H,31,32)(H,26,28,29) |
| InChIKey | HXQHKRDPNSIKHY-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 143.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.48 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|