C8H8N4S — CID 91618965
2,4-diaminoquinazoline-6-thiol (PubChem CID 91618965) has the molecular formula C8H8N4S and a molecular weight of 192.25 g/mol. Its IUPAC name is 2,4-diaminoquinazoline-6-thiol.
| Compound Name | 2,4-diaminoquinazoline-6-thiol |
|---|---|
| PubChem CID | 91618965 |
| Molecular Formula | C8H8N4S |
| Molecular Weight | 192.25 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 2,4-diaminoquinazoline-6-thiol |
| SMILES | Nc1nc(N)c2cc(S)ccc2n1 |
| InChI | InChI=1S/C8H8N4S/c9-7-5-3-4(13)1-2-6(5)11-8(10)12-7/h1-3,13H,(H4,9,10,11,12) |
| InChIKey | CUJQJMFTLYLBHY-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.25 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|