C14H13N5S — CID 86119311
6-(4-aminophenyl)sulfanylquinazoline-2,4-diamine (PubChem CID 86119311) has the molecular formula C14H13N5S and a molecular weight of 283.36 g/mol. Its IUPAC name is 6-(4-aminophenyl)sulfanylquinazoline-2,4-diamine.
| Compound Name | 6-(4-aminophenyl)sulfanylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 86119311 |
| Molecular Formula | C14H13N5S |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 6-(4-aminophenyl)sulfanylquinazoline-2,4-diamine |
| SMILES | Nc1ccc(Sc2ccc3nc(N)nc(N)c3c2)cc1 |
| InChI | InChI=1S/C14H13N5S/c15-8-1-3-9(4-2-8)20-10-5-6-12-11(7-10)13(16)19-14(17)18-12/h1-7H,15H2,(H4,16,17,18,19) |
| InChIKey | VSYQKQMAVICBIK-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 103.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|