C14H11FN4 — CID 24810151
6-(4-fluorophenyl)quinazoline-2,4-diamine (PubChem CID 24810151) has the molecular formula C14H11FN4 and a molecular weight of 254.27 g/mol. Its IUPAC name is 6-(4-fluorophenyl)quinazoline-2,4-diamine.
| Compound Name | 6-(4-fluorophenyl)quinazoline-2,4-diamine |
|---|---|
| PubChem CID | 24810151 |
| Molecular Formula | C14H11FN4 |
| Molecular Weight | 254.27 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | 6-(4-fluorophenyl)quinazoline-2,4-diamine |
| SMILES | Nc1nc(N)c2cc(-c3ccc(F)cc3)ccc2n1 |
| InChI | InChI=1S/C14H11FN4/c15-10-4-1-8(2-5-10)9-3-6-12-11(7-9)13(16)19-14(17)18-12/h1-7H,(H4,16,17,18,19) |
| InChIKey | UTGCUNAKMHMKNJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.27 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |