C14H12FN5 — CID 24810108
6-(4-fluorophenyl)-4-hydrazinylquinazolin-2-amine (PubChem CID 24810108) has the molecular formula C14H12FN5 and a molecular weight of 269.28 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-4-hydrazinylquinazolin-2-amine.
| Compound Name | 6-(4-fluorophenyl)-4-hydrazinylquinazolin-2-amine |
|---|---|
| PubChem CID | 24810108 |
| Molecular Formula | C14H12FN5 |
| Molecular Weight | 269.28 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | 6-(4-fluorophenyl)-4-hydrazinylquinazolin-2-amine |
| SMILES | NNc1nc(N)nc2ccc(-c3ccc(F)cc3)cc12 |
| InChI | InChI=1S/C14H12FN5/c15-10-4-1-8(2-5-10)9-3-6-12-11(7-9)13(20-17)19-14(16)18-12/h1-7H,17H2,(H3,16,18,19,20) |
| InChIKey | JKCQARNJKJLPRR-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|