C21H16F2N4 — CID 134098551
6-[3-fluoro-5-(4-fluorophenyl)phenyl]-5-methylquinazoline-2,4-diamine (PubChem CID 134098551) has the molecular formula C21H16F2N4 and a molecular weight of 362.38 g/mol. Its IUPAC name is 6-[3-fluoro-5-(4-fluorophenyl)phenyl]-5-methylquinazoline-2,4-diamine.
| Compound Name | 6-[3-fluoro-5-(4-fluorophenyl)phenyl]-5-methylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 134098551 |
| Molecular Formula | C21H16F2N4 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 6-[3-fluoro-5-(4-fluorophenyl)phenyl]-5-methylquinazoline-2,4-diamine |
| SMILES | Cc1c(-c2cc(F)cc(-c3ccc(F)cc3)c2)ccc2nc(N)nc(N)c12 |
| InChI | InChI=1S/C21H16F2N4/c1-11-17(6-7-18-19(11)20(24)27-21(25)26-18)14-8-13(9-16(23)10-14)12-2-4-15(22)5-3-12/h2-10H,1H3,(H4,24,25,26,27) |
| InChIKey | RDRNRHUIUOXLCL-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |