C22H19FN4 — CID 134113376
6-[3-(4-fluorophenyl)-2-methylphenyl]-5-methylquinazoline-2,4-diamine (PubChem CID 134113376) has the molecular formula C22H19FN4 and a molecular weight of 358.42 g/mol. Its IUPAC name is 6-[3-(4-fluorophenyl)-2-methylphenyl]-5-methylquinazoline-2,4-diamine.
| Compound Name | 6-[3-(4-fluorophenyl)-2-methylphenyl]-5-methylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 134113376 |
| Molecular Formula | C22H19FN4 |
| Molecular Weight | 358.42 g/mol |
| Exact Mass | 358.16 |
| IUPAC Name | 6-[3-(4-fluorophenyl)-2-methylphenyl]-5-methylquinazoline-2,4-diamine |
| SMILES | Cc1c(-c2ccc(F)cc2)cccc1-c1ccc2nc(N)nc(N)c2c1C |
| InChI | InChI=1S/C22H19FN4/c1-12-16(14-6-8-15(23)9-7-14)4-3-5-17(12)18-10-11-19-20(13(18)2)21(24)27-22(25)26-19/h3-11H,1-2H3,(H4,24,25,26,27) |
| InChIKey | SPYUUCLHRVGOHE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |