C15H13ClN4 — CID 134112794
6-(2-chlorophenyl)-5-methylquinazoline-2,4-diamine (PubChem CID 134112794) has the molecular formula C15H13ClN4 and a molecular weight of 284.75 g/mol. Its IUPAC name is 6-(2-chlorophenyl)-5-methylquinazoline-2,4-diamine.
| Compound Name | 6-(2-chlorophenyl)-5-methylquinazoline-2,4-diamine |
|---|---|
| PubChem CID | 134112794 |
| Molecular Formula | C15H13ClN4 |
| Molecular Weight | 284.75 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | 6-(2-chlorophenyl)-5-methylquinazoline-2,4-diamine |
| SMILES | Cc1c(-c2ccccc2Cl)ccc2nc(N)nc(N)c12 |
| InChI | InChI=1S/C15H13ClN4/c1-8-9(10-4-2-3-5-11(10)16)6-7-12-13(8)14(17)20-15(18)19-12/h2-7H,1H3,(H4,17,18,19,20) |
| InChIKey | KEUJYXMYZQLXIA-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.75 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |