C17H25N3 — CID 63483498
6-N,6-N-diethyl-2-methyl-4-N-propylquinoline-4,6-diamine (PubChem CID 63483498) has the molecular formula C17H25N3 and a molecular weight of 271.41 g/mol. Its IUPAC name is 6-N,6-N-diethyl-2-methyl-4-N-propylquinoline-4,6-diamine.
| Compound Name | 6-N,6-N-diethyl-2-methyl-4-N-propylquinoline-4,6-diamine |
|---|---|
| PubChem CID | 63483498 |
| Molecular Formula | C17H25N3 |
| Molecular Weight | 271.41 g/mol |
| Exact Mass | 271.20 |
| IUPAC Name | 6-N,6-N-diethyl-2-methyl-4-N-propylquinoline-4,6-diamine |
| SMILES | CCCNc1cc(C)nc2ccc(N(CC)CC)cc12 |
| InChI | InChI=1S/C17H25N3/c1-5-10-18-17-11-13(4)19-16-9-8-14(12-15(16)17)20(6-2)7-3/h8-9,11-12H,5-7,10H2,1-4H3,(H,18,19) |
| InChIKey | MKKFSJIVEDPJQU-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.41 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |