C18H27N3 — CID 63483860
2-tert-butyl-6-N,6-N-diethyl-4-N-methylquinoline-4,6-diamine (PubChem CID 63483860) has the molecular formula C18H27N3 and a molecular weight of 285.44 g/mol. Its IUPAC name is 2-tert-butyl-6-N,6-N-diethyl-4-N-methylquinoline-4,6-diamine.
| Compound Name | 2-tert-butyl-6-N,6-N-diethyl-4-N-methylquinoline-4,6-diamine |
|---|---|
| PubChem CID | 63483860 |
| Molecular Formula | C18H27N3 |
| Molecular Weight | 285.44 g/mol |
| Exact Mass | 285.22 |
| IUPAC Name | 2-tert-butyl-6-N,6-N-diethyl-4-N-methylquinoline-4,6-diamine |
| SMILES | CCN(CC)c1ccc2nc(C(C)(C)C)cc(NC)c2c1 |
| InChI | InChI=1S/C18H27N3/c1-7-21(8-2)13-9-10-15-14(11-13)16(19-6)12-17(20-15)18(3,4)5/h9-12H,7-8H2,1-6H3,(H,19,20) |
| InChIKey | UBBCSDCQOBDYEC-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.44 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |